C12H15Cl3N2 — CID 163621205
(2S,3S)-2-methyl-N-[(2,3,5-trichlorophenyl)methyl]pyrrolidin-3-amine (PubChem CID 163621205) has the molecular formula C12H15Cl3N2 and a molecular weight of 293.62 g/mol. Its IUPAC name is (2S,3S)-2-methyl-N-[(2,3,5-trichlorophenyl)methyl]pyrrolidin-3-amine.
| Compound Name | (2S,3S)-2-methyl-N-[(2,3,5-trichlorophenyl)methyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 163621205 |
| Molecular Formula | C12H15Cl3N2 |
| Molecular Weight | 293.62 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | (2S,3S)-2-methyl-N-[(2,3,5-trichlorophenyl)methyl]pyrrolidin-3-amine |
| SMILES | C[C@@H]1NCC[C@@H]1NCc1cc(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C12H15Cl3N2/c1-7-11(2-3-16-7)17-6-8-4-9(13)5-10(14)12(8)15/h4-5,7,11,16-17H,2-3,6H2,1H3/t7-,11-/m0/s1 |
| InChIKey | HOGDULRNNYNQOF-CPCISQLKSA-N |
| XLogP | 3.49 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.62 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|