C11H12ClNO3S — CID 163621360
S-methyl (2R)-2-(2-chlorophenyl)-2-(methoxycarbonylamino)ethanethioate (PubChem CID 163621360) has the molecular formula C11H12ClNO3S and a molecular weight of 273.74 g/mol. Its IUPAC name is S-methyl (2R)-2-(2-chlorophenyl)-2-(methoxycarbonylamino)ethanethioate.
| Compound Name | S-methyl (2R)-2-(2-chlorophenyl)-2-(methoxycarbonylamino)ethanethioate |
|---|---|
| PubChem CID | 163621360 |
| Molecular Formula | C11H12ClNO3S |
| Molecular Weight | 273.74 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | S-methyl (2R)-2-(2-chlorophenyl)-2-(methoxycarbonylamino)ethanethioate |
| SMILES | COC(=O)N[C@@H](C(=O)SC)c1ccccc1Cl |
| InChI | InChI=1S/C11H12ClNO3S/c1-16-11(15)13-9(10(14)17-2)7-5-3-4-6-8(7)12/h3-6,9H,1-2H3,(H,13,15)/t9-/m1/s1 |
| InChIKey | HOJNIJSMXCFOCX-SECBINFHSA-N |
| XLogP | 2.63 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.74 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|