C12H15ClFNO3 — CID 143630066
ethane;fluoro N-[1-(2-chlorophenyl)-2-oxopropyl]carbamate (PubChem CID 143630066) has the molecular formula C12H15ClFNO3 and a molecular weight of 275.71 g/mol. Its IUPAC name is ethane;fluoro N-[1-(2-chlorophenyl)-2-oxopropyl]carbamate.
| Compound Name | ethane;fluoro N-[1-(2-chlorophenyl)-2-oxopropyl]carbamate |
|---|---|
| PubChem CID | 143630066 |
| Molecular Formula | C12H15ClFNO3 |
| Molecular Weight | 275.71 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | ethane;fluoro N-[1-(2-chlorophenyl)-2-oxopropyl]carbamate |
| SMILES | CC.CC(=O)C(NC(=O)OF)c1ccccc1Cl |
| InChI | InChI=1S/C10H9ClFNO3.C2H6/c1-6(14)9(13-10(15)16-12)7-4-2-3-5-8(7)11;1-2/h2-5,9H,1H3,(H,13,15);1-2H3 |
| InChIKey | LXQXANIZKIYKAB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.71 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |