C14H24N3O12P3 — CID 163622761
[(1S)-2-[2-[(2R)-2-(4-amino-2-oxopyrimidin-1-yl)-1-hydroxycyclopropyl]ethyl]cyclopentyl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate (PubChem CID 163622761) has the molecular formula C14H24N3O12P3 and a molecular weight of 519.28 g/mol. Its IUPAC name is [(1S)-2-[2-[(2R)-2-(4-amino-2-oxopyrimidin-1-yl)-1-hydroxycyclopropyl]ethyl]cyclopentyl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate.
| Compound Name | [(1S)-2-[2-[(2R)-2-(4-amino-2-oxopyrimidin-1-yl)-1-hydroxycyclopropyl]ethyl]cyclopentyl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 163622761 |
| Molecular Formula | C14H24N3O12P3 |
| Molecular Weight | 519.28 g/mol |
| Exact Mass | 519.06 |
| IUPAC Name | [(1S)-2-[2-[(2R)-2-(4-amino-2-oxopyrimidin-1-yl)-1-hydroxycyclopropyl]ethyl]cyclopentyl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate |
| SMILES | Nc1ccn([C@@H]2CC2(O)CCC2CCC[C@@H]2OP(=O)(O)OP(=O)(O)OP(=O)(O)O)c(=O)n1 |
| InChI | InChI=1S/C14H24N3O12P3/c15-12-5-7-17(13(18)16-12)11-8-14(11,19)6-4-9-2-1-3-10(9)27-31(23,24)29-32(25,26)28-30(20,21)22/h5,7,9-11,19H,1-4,6,8H2,(H,23,24)(H,25,26)(H2,15,16,18)(H2,20,21,22)/t9?,10-,11+,14?/m0/s1 |
| InChIKey | HPNKCXLPUGTLST-DUEVMTECSA-N |
| XLogP | 0.79 |
| TPSA | 240.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.28 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|