C24H29N3O2S2 — CID 163623713
4-(2,5-dimethylphenyl)sulfanyl-3-(4-pent-1-en-3-ylpiperazin-1-yl)sulfonylbenzonitrile (PubChem CID 163623713) has the molecular formula C24H29N3O2S2 and a molecular weight of 455.65 g/mol. Its IUPAC name is 4-(2,5-dimethylphenyl)sulfanyl-3-(4-pent-1-en-3-ylpiperazin-1-yl)sulfonylbenzonitrile.
| Compound Name | 4-(2,5-dimethylphenyl)sulfanyl-3-(4-pent-1-en-3-ylpiperazin-1-yl)sulfonylbenzonitrile |
|---|---|
| PubChem CID | 163623713 |
| Molecular Formula | C24H29N3O2S2 |
| Molecular Weight | 455.65 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 4-(2,5-dimethylphenyl)sulfanyl-3-(4-pent-1-en-3-ylpiperazin-1-yl)sulfonylbenzonitrile |
| SMILES | C=CC(CC)N1CCN(S(=O)(=O)c2cc(C#N)ccc2Sc2cc(C)ccc2C)CC1 |
| InChI | InChI=1S/C24H29N3O2S2/c1-5-21(6-2)26-11-13-27(14-12-26)31(28,29)24-16-20(17-25)9-10-22(24)30-23-15-18(3)7-8-19(23)4/h5,7-10,15-16,21H,1,6,11-14H2,2-4H3 |
| InChIKey | HQHWEGARXASBHQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.65 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|