C16H9N3O2 — CID 163624340
2-(benzotriazol-2-yl)-5-buta-1,3-diynoxyphenol (PubChem CID 163624340) has the molecular formula C16H9N3O2 and a molecular weight of 275.27 g/mol. Its IUPAC name is 2-(benzotriazol-2-yl)-5-buta-1,3-diynoxyphenol.
| Compound Name | 2-(benzotriazol-2-yl)-5-buta-1,3-diynoxyphenol |
|---|---|
| PubChem CID | 163624340 |
| Molecular Formula | C16H9N3O2 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 2-(benzotriazol-2-yl)-5-buta-1,3-diynoxyphenol |
| SMILES | C#CC#COc1ccc(-n2nc3ccccc3n2)c(O)c1 |
| InChI | InChI=1S/C16H9N3O2/c1-2-3-10-21-12-8-9-15(16(20)11-12)19-17-13-6-4-5-7-14(13)18-19/h1,4-9,11,20H |
| InChIKey | BPDJICVGPYEYQP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|