C31H22N6 — CID 163624546
8-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-4,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10-pentaene (PubChem CID 163624546) has the molecular formula C31H22N6 and a molecular weight of 478.56 g/mol. Its IUPAC name is 8-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-4,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10-pentaene.
| Compound Name | 8-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-4,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10-pentaene |
|---|---|
| PubChem CID | 163624546 |
| Molecular Formula | C31H22N6 |
| Molecular Weight | 478.56 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 8-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-4,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10-pentaene |
| SMILES | C1=Cc2c(c3cnccc3n2-c2ccc(-c3cc(-c4ccccn4)nc(-c4ccccn4)c3)cc2)CN1 |
| InChI | InChI=1S/C31H22N6/c1-3-13-34-26(5-1)28-17-22(18-29(36-28)27-6-2-4-14-35-27)21-7-9-23(10-8-21)37-30-11-15-32-19-24(30)25-20-33-16-12-31(25)37/h1-19,33H,20H2 |
| InChIKey | HQYNSAYTUSLIKK-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.56 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |