C18H31F2NO7S — CID 163631523
2-[6-[(1-ethylcyclohexyl)oxycarbonylamino]heptoxy]-1,1-difluoro-2-oxoethanesulfonic acid (PubChem CID 163631523) has the molecular formula C18H31F2NO7S and a molecular weight of 443.51 g/mol. Its IUPAC name is 2-[6-[(1-ethylcyclohexyl)oxycarbonylamino]heptoxy]-1,1-difluoro-2-oxoethanesulfonic acid.
| Compound Name | 2-[6-[(1-ethylcyclohexyl)oxycarbonylamino]heptoxy]-1,1-difluoro-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 163631523 |
| Molecular Formula | C18H31F2NO7S |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 2-[6-[(1-ethylcyclohexyl)oxycarbonylamino]heptoxy]-1,1-difluoro-2-oxoethanesulfonic acid |
| SMILES | CCC1(OC(=O)NC(C)CCCCCOC(=O)C(F)(F)S(=O)(=O)O)CCCCC1 |
| InChI | InChI=1S/C18H31F2NO7S/c1-3-17(11-7-5-8-12-17)28-16(23)21-14(2)10-6-4-9-13-27-15(22)18(19,20)29(24,25)26/h14H,3-13H2,1-2H3,(H,21,23)(H,24,25,26) |
| InChIKey | HWMNCLCDZVUKRW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|