C32H30Cl2F2N2O4 — CID 163632164
4-[[(1R,2R,3R,4S)-2-(3-chloro-2-fluorophenyl)-3-(4-chloro-2-fluorophenyl)-4-(2,2-dimethylpropyl)-3-isocyanocyclopentanecarbonyl]amino]-3-methoxybenzoic acid (PubChem CID 163632164) has the molecular formula C32H30Cl2F2N2O4 and a molecular weight of 615.50 g/mol. Its IUPAC name is 4-[[(1R,2R,3R,4S)-2-(3-chloro-2-fluorophenyl)-3-(4-chloro-2-fluorophenyl)-4-(2,2-dimethylpropyl)-3-isocyanocyclopentanecarbonyl]amino]-3-methoxybenzoic acid.
| Compound Name | 4-[[(1R,2R,3R,4S)-2-(3-chloro-2-fluorophenyl)-3-(4-chloro-2-fluorophenyl)-4-(2,2-dimethylpropyl)-3-isocyanocyclopentanecarbonyl]amino]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 163632164 |
| Molecular Formula | C32H30Cl2F2N2O4 |
| Molecular Weight | 615.50 g/mol |
| Exact Mass | 614.16 |
| IUPAC Name | 4-[[(1R,2R,3R,4S)-2-(3-chloro-2-fluorophenyl)-3-(4-chloro-2-fluorophenyl)-4-(2,2-dimethylpropyl)-3-isocyanocyclopentanecarbonyl]amino]-3-methoxybenzoic acid |
| SMILES | [C-]#[N+][C@]1(c2ccc(Cl)cc2F)[C@H](CC(C)(C)C)C[C@@H](C(=O)Nc2ccc(C(=O)O)cc2OC)[C@@H]1c1cccc(Cl)c1F |
| InChI | InChI=1S/C32H30Cl2F2N2O4/c1-31(2,3)16-18-14-21(29(39)38-25-12-9-17(30(40)41)13-26(25)42-5)27(20-7-6-8-23(34)28(20)36)32(18,37-4)22-11-10-19(33)15-24(22)35/h6-13,15,18,21,27H,14,16H2,1-3,5H3,(H,38,39)(H,40,41)/t18-,21+,27-,32-/m0/s1 |
| InChIKey | IFOTXPLMYYEBEF-BMECNEOESA-N |
| XLogP | 8.59 |
| TPSA | 79.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.50 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|