C31H32Cl2FN3O4 — CID 164592025
4-[[(2'S,3S,3'R,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)spiro[1,2-dihydroindole-3,4'-pyrrolidine]-2'-carbonyl]amino]-3-methoxybenzoic acid (PubChem CID 164592025) has the molecular formula C31H32Cl2FN3O4 and a molecular weight of 600.52 g/mol. Its IUPAC name is 4-[[(2'S,3S,3'R,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)spiro[1,2-dihydroindole-3,4'-pyrrolidine]-2'-carbonyl]amino]-3-methoxybenzoic acid.
| Compound Name | 4-[[(2'S,3S,3'R,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)spiro[1,2-dihydroindole-3,4'-pyrrolidine]-2'-carbonyl]amino]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 164592025 |
| Molecular Formula | C31H32Cl2FN3O4 |
| Molecular Weight | 600.52 g/mol |
| Exact Mass | 599.18 |
| IUPAC Name | 4-[[(2'S,3S,3'R,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)spiro[1,2-dihydroindole-3,4'-pyrrolidine]-2'-carbonyl]amino]-3-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1NC(=O)[C@H]1N[C@@H](CC(C)(C)C)[C@@]2(CNc3cc(Cl)ccc32)[C@@H]1c1cccc(Cl)c1F |
| InChI | InChI=1S/C31H32Cl2FN3O4/c1-30(2,3)14-24-31(15-35-22-13-17(32)9-10-19(22)31)25(18-6-5-7-20(33)26(18)34)27(37-24)28(38)36-21-11-8-16(29(39)40)12-23(21)41-4/h5-13,24-25,27,35,37H,14-15H2,1-4H3,(H,36,38)(H,39,40)/t24-,25+,27-,31-/m0/s1 |
| InChIKey | VKSSIXZETBBSJT-UUKVNIOTSA-N |
| XLogP | 6.70 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.52 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |