C31H36Cl2FN4O3P — CID 164591938
4-[[[(2'S,3S,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)spiro[1,2-dihydroindole-3,4'-pyrrolidine]-2'-yl]-methylphosphoryl]amino]-3-methoxybenzamide (PubChem CID 164591938) has the molecular formula C31H36Cl2FN4O3P and a molecular weight of 633.53 g/mol. Its IUPAC name is 4-[[[(2'S,3S,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)spiro[1,2-dihydroindole-3,4'-pyrrolidine]-2'-yl]-methylphosphoryl]amino]-3-methoxybenzamide.
| Compound Name | 4-[[[(2'S,3S,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)spiro[1,2-dihydroindole-3,4'-pyrrolidine]-2'-yl]-methylphosphoryl]amino]-3-methoxybenzamide |
|---|---|
| PubChem CID | 164591938 |
| Molecular Formula | C31H36Cl2FN4O3P |
| Molecular Weight | 633.53 g/mol |
| Exact Mass | 632.19 |
| IUPAC Name | 4-[[[(2'S,3S,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2,2-dimethylpropyl)spiro[1,2-dihydroindole-3,4'-pyrrolidine]-2'-yl]-methylphosphoryl]amino]-3-methoxybenzamide |
| SMILES | COc1cc(C(N)=O)ccc1NP(C)(=O)[C@@H]1N[C@@H](CC(C)(C)C)[C@@]2(CNc3cc(Cl)ccc32)[C@H]1c1cccc(Cl)c1F |
| InChI | InChI=1S/C31H36Cl2FN4O3P/c1-30(2,3)15-25-31(16-36-23-14-18(32)10-11-20(23)31)26(19-7-6-8-21(33)27(19)34)29(37-25)42(5,40)38-22-12-9-17(28(35)39)13-24(22)41-4/h6-14,25-26,29,36-37H,15-16H2,1-5H3,(H2,35,39)(H,38,40)/t25-,26-,29-,31-,42?/m0/s1 |
| InChIKey | HYCIKSHMLMPDCU-HCJPGUHWSA-N |
| XLogP | 7.44 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.53 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|