C33H37Cl2F2N3O3 — CID 174372473
(2R,3S,4S,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-5-(2,2-dimethylpropyl)-N-[4-(ethylcarbamoyl)-2-methoxyphenyl]-4-methylpyrrolidine-2-carboxamide (PubChem CID 174372473) has the molecular formula C33H37Cl2F2N3O3 and a molecular weight of 632.58 g/mol. Its IUPAC name is (2R,3S,4S,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-5-(2,2-dimethylpropyl)-N-[4-(ethylcarbamoyl)-2-methoxyphenyl]-4-methylpyrrolidine-2-carboxamide.
| Compound Name | (2R,3S,4S,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-5-(2,2-dimethylpropyl)-N-[4-(ethylcarbamoyl)-2-methoxyphenyl]-4-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 174372473 |
| Molecular Formula | C33H37Cl2F2N3O3 |
| Molecular Weight | 632.58 g/mol |
| Exact Mass | 631.22 |
| IUPAC Name | (2R,3S,4S,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-5-(2,2-dimethylpropyl)-N-[4-(ethylcarbamoyl)-2-methoxyphenyl]-4-methylpyrrolidine-2-carboxamide |
| SMILES | CCNC(=O)c1ccc(NC(=O)[C@@H]2N[C@@H](CC(C)(C)C)[C@](C)(c3ccc(Cl)cc3F)[C@H]2c2cccc(Cl)c2F)c(OC)c1 |
| InChI | InChI=1S/C33H37Cl2F2N3O3/c1-7-38-30(41)18-11-14-24(25(15-18)43-6)39-31(42)29-27(20-9-8-10-22(35)28(20)37)33(5,26(40-29)17-32(2,3)4)21-13-12-19(34)16-23(21)36/h8-16,26-27,29,40H,7,17H2,1-6H3,(H,38,41)(H,39,42)/t26-,27-,29+,33-/m0/s1 |
| InChIKey | NQLGVSNFLLSSOS-HNZCNSHZSA-N |
| XLogP | 7.49 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.58 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |