C24H24O4S — CID 163634943
7-(4-butan-2-ylphenyl)sulfanyl-3,10-dihydroxy-3,4,6,7-tetrahydroanthracene-2,9-dione (PubChem CID 163634943) has the molecular formula C24H24O4S and a molecular weight of 408.52 g/mol. Its IUPAC name is 7-(4-butan-2-ylphenyl)sulfanyl-3,10-dihydroxy-3,4,6,7-tetrahydroanthracene-2,9-dione.
| Compound Name | 7-(4-butan-2-ylphenyl)sulfanyl-3,10-dihydroxy-3,4,6,7-tetrahydroanthracene-2,9-dione |
|---|---|
| PubChem CID | 163634943 |
| Molecular Formula | C24H24O4S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 7-(4-butan-2-ylphenyl)sulfanyl-3,10-dihydroxy-3,4,6,7-tetrahydroanthracene-2,9-dione |
| SMILES | CCC(C)c1ccc(SC2C=C3C(=O)C4=CC(=O)C(O)CC4=C(O)C3=CC2)cc1 |
| InChI | InChI=1S/C24H24O4S/c1-3-13(2)14-4-6-15(7-5-14)29-16-8-9-17-18(10-16)24(28)20-12-22(26)21(25)11-19(20)23(17)27/h4-7,9-10,12-13,16,21,25,27H,3,8,11H2,1-2H3 |
| InChIKey | VZGGEDVWIKVWDG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |