C10H16N2O4S — CID 163635565
ethyl 3-methyl-1,1-dioxo-6-prop-2-enyl-2,3-dihydro-1,2,6-thiadiazine-4-carboxylate (PubChem CID 163635565) has the molecular formula C10H16N2O4S and a molecular weight of 260.31 g/mol. Its IUPAC name is ethyl 3-methyl-1,1-dioxo-6-prop-2-enyl-2,3-dihydro-1,2,6-thiadiazine-4-carboxylate.
| Compound Name | ethyl 3-methyl-1,1-dioxo-6-prop-2-enyl-2,3-dihydro-1,2,6-thiadiazine-4-carboxylate |
|---|---|
| PubChem CID | 163635565 |
| Molecular Formula | C10H16N2O4S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | ethyl 3-methyl-1,1-dioxo-6-prop-2-enyl-2,3-dihydro-1,2,6-thiadiazine-4-carboxylate |
| SMILES | C=CCN1C=C(C(=O)OCC)C(C)NS1(=O)=O |
| InChI | InChI=1S/C10H16N2O4S/c1-4-6-12-7-9(10(13)16-5-2)8(3)11-17(12,14)15/h4,7-8,11H,1,5-6H2,2-3H3 |
| InChIKey | HZUHVCNCMZCHDA-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|