C45H25F2I3N4 — CID 163637292
3-[4-[4-(3,5-difluorophenyl)-6-[4-(1,10-phenanthrolin-3-yl)phenyl]-1λ3,3λ3,5λ3-triiodacyclohexa-1,3,5-trien-2-yl]phenyl]-1,10-phenanthroline (PubChem CID 163637292) has the molecular formula C45H25F2I3N4 and a molecular weight of 1040.43 g/mol. Its IUPAC name is 3-[4-[4-(3,5-difluorophenyl)-6-[4-(1,10-phenanthrolin-3-yl)phenyl]-1λ3,3λ3,5λ3-triiodacyclohexa-1,3,5-trien-2-yl]phenyl]-1,10-phenanthroline.
| Compound Name | 3-[4-[4-(3,5-difluorophenyl)-6-[4-(1,10-phenanthrolin-3-yl)phenyl]-1λ3,3λ3,5λ3-triiodacyclohexa-1,3,5-trien-2-yl]phenyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 163637292 |
| Molecular Formula | C45H25F2I3N4 |
| Molecular Weight | 1040.43 g/mol |
| Exact Mass | 1039.92 |
| IUPAC Name | 3-[4-[4-(3,5-difluorophenyl)-6-[4-(1,10-phenanthrolin-3-yl)phenyl]-1λ3,3λ3,5λ3-triiodacyclohexa-1,3,5-trien-2-yl]phenyl]-1,10-phenanthroline |
| SMILES | Fc1cc(F)cc(C2=IC(c3ccc(-c4cnc5c(ccc6cccnc65)c4)cc3)=IC(c3ccc(-c4cnc5c(ccc6cccnc65)c4)cc3)=I2)c1 |
| InChI | InChI=1S/C45H25F2I3N4/c46-37-21-34(22-38(47)23-37)45-49-43(30-11-5-26(6-12-30)35-19-32-15-9-28-3-1-17-51-39(28)41(32)53-24-35)48-44(50-45)31-13-7-27(8-14-31)36-20-33-16-10-29-4-2-18-52-40(29)42(33)54-25-36/h1-25H |
| InChIKey | IBGNKHSEYPDAFA-UHFFFAOYSA-N |
| XLogP | 12.25 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1040.43 |
| LogP ≤ 5 | 12.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|