C24H14F2N2Re — CID 59104701
3,8-bis(4-fluorophenyl)-1,10-phenanthroline;rhenium (PubChem CID 59104701) has the molecular formula C24H14F2N2Re and a molecular weight of 554.59 g/mol. Its IUPAC name is 3,8-bis(4-fluorophenyl)-1,10-phenanthroline;rhenium.
| Compound Name | 3,8-bis(4-fluorophenyl)-1,10-phenanthroline;rhenium |
|---|---|
| PubChem CID | 59104701 |
| Molecular Formula | C24H14F2N2Re |
| Molecular Weight | 554.59 g/mol |
| Exact Mass | 555.07 |
| IUPAC Name | 3,8-bis(4-fluorophenyl)-1,10-phenanthroline;rhenium |
| SMILES | Fc1ccc(-c2cnc3c(ccc4cc(-c5ccc(F)cc5)cnc43)c2)cc1.[Re] |
| InChI | InChI=1S/C24H14F2N2.Re/c25-21-7-3-15(4-8-21)19-11-17-1-2-18-12-20(16-5-9-22(26)10-6-16)14-28-24(18)23(17)27-13-19;/h1-14H; |
| InChIKey | YNVOSWOXRUVYJJ-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.59 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|