C24H16N2S2 — CID 136600374
4-[8-(4-sulfanylphenyl)-1,10-phenanthrolin-3-yl]benzenethiol (PubChem CID 136600374) has the molecular formula C24H16N2S2 and a molecular weight of 396.54 g/mol. Its IUPAC name is 4-[8-(4-sulfanylphenyl)-1,10-phenanthrolin-3-yl]benzenethiol.
| Compound Name | 4-[8-(4-sulfanylphenyl)-1,10-phenanthrolin-3-yl]benzenethiol |
|---|---|
| PubChem CID | 136600374 |
| Molecular Formula | C24H16N2S2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 4-[8-(4-sulfanylphenyl)-1,10-phenanthrolin-3-yl]benzenethiol |
| SMILES | Sc1ccc(-c2cnc3c(ccc4cc(-c5ccc(S)cc5)cnc43)c2)cc1 |
| InChI | InChI=1S/C24H16N2S2/c27-21-7-3-15(4-8-21)19-11-17-1-2-18-12-20(16-5-9-22(28)10-6-16)14-26-24(18)23(17)25-13-19/h1-14,27-28H |
| InChIKey | PARCWYKFNCESIN-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 25.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|