C20H16FIN2O4 — CID 163637836
(3R)-4-[4-(2-fluoro-5-iodophenyl)phenyl]-3-(1,3-oxazole-5-carbonylamino)butanoic acid (PubChem CID 163637836) has the molecular formula C20H16FIN2O4 and a molecular weight of 494.26 g/mol. Its IUPAC name is (3R)-4-[4-(2-fluoro-5-iodophenyl)phenyl]-3-(1,3-oxazole-5-carbonylamino)butanoic acid.
| Compound Name | (3R)-4-[4-(2-fluoro-5-iodophenyl)phenyl]-3-(1,3-oxazole-5-carbonylamino)butanoic acid |
|---|---|
| PubChem CID | 163637836 |
| Molecular Formula | C20H16FIN2O4 |
| Molecular Weight | 494.26 g/mol |
| Exact Mass | 494.01 |
| IUPAC Name | (3R)-4-[4-(2-fluoro-5-iodophenyl)phenyl]-3-(1,3-oxazole-5-carbonylamino)butanoic acid |
| SMILES | O=C(O)C[C@@H](Cc1ccc(-c2cc(I)ccc2F)cc1)NC(=O)c1cnco1 |
| InChI | InChI=1S/C20H16FIN2O4/c21-17-6-5-14(22)8-16(17)13-3-1-12(2-4-13)7-15(9-19(25)26)24-20(27)18-10-23-11-28-18/h1-6,8,10-11,15H,7,9H2,(H,24,27)(H,25,26)/t15-/m1/s1 |
| InChIKey | IBSFWENWIXKLTP-OAHLLOKOSA-N |
| XLogP | 3.90 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.26 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|