C38H40O12 — CID 163638227
[3-methyl-4-[1-[4-(4-prop-2-enoyloxybutoxycarbonyloxy)phenyl]ethenoxy]phenyl] 4-(4-prop-2-enoyloxybutoxymethoxy)benzoate (PubChem CID 163638227) has the molecular formula C38H40O12 and a molecular weight of 688.73 g/mol. Its IUPAC name is [3-methyl-4-[1-[4-(4-prop-2-enoyloxybutoxycarbonyloxy)phenyl]ethenoxy]phenyl] 4-(4-prop-2-enoyloxybutoxymethoxy)benzoate.
| Compound Name | [3-methyl-4-[1-[4-(4-prop-2-enoyloxybutoxycarbonyloxy)phenyl]ethenoxy]phenyl] 4-(4-prop-2-enoyloxybutoxymethoxy)benzoate |
|---|---|
| PubChem CID | 163638227 |
| Molecular Formula | C38H40O12 |
| Molecular Weight | 688.73 g/mol |
| Exact Mass | 688.25 |
| IUPAC Name | [3-methyl-4-[1-[4-(4-prop-2-enoyloxybutoxycarbonyloxy)phenyl]ethenoxy]phenyl] 4-(4-prop-2-enoyloxybutoxymethoxy)benzoate |
| SMILES | C=CC(=O)OCCCCOCOc1ccc(C(=O)Oc2ccc(OC(=C)c3ccc(OC(=O)OCCCCOC(=O)C=C)cc3)c(C)c2)cc1 |
| InChI | InChI=1S/C38H40O12/c1-5-35(39)44-22-8-7-21-43-26-47-31-15-13-30(14-16-31)37(41)49-33-19-20-34(27(3)25-33)48-28(4)29-11-17-32(18-12-29)50-38(42)46-24-10-9-23-45-36(40)6-2/h5-6,11-20,25H,1-2,4,7-10,21-24,26H2,3H3 |
| InChIKey | ICAFFLDIXJJRDH-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.73 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|