About (2R)-1-fluoro-2,3-dimethylhept-6-ene-1-thiol
(2R)-1-fluoro-2,3-dimethylhept-6-ene-1-thiol (PubChem CID 163638496) has the molecular formula C9H17FS
and a molecular weight of 176.30 g/mol. Its IUPAC name is (2R)-1-fluoro-2,3-dimethylhept-6-ene-1-thiol.
Molecular Properties
| Compound Name | (2R)-1-fluoro-2,3-dimethylhept-6-ene-1-thiol |
| PubChem CID | 163638496 |
| Molecular Formula | C9H17FS |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | (2R)-1-fluoro-2,3-dimethylhept-6-ene-1-thiol |
| SMILES | C=CCCC(C)[C@@H](C)C(F)S |
| InChI | InChI=1S/C9H17FS/c1-4-5-6-7(2)8(3)9(10)11/h4,7-9,11H,1,5-6H2,2-3H3/t7?,8-,9?/m1/s1 |
| InChIKey | ICFZFOVFTUFNGO-QJAFJHJLSA-N |
| XLogP | 3.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2R)-1-fluoro-2,3-dimethylhept-6-ene-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-fluoro-2,3-dimethylhept-6-ene-1-thiol?
The IUPAC name of (2R)-1-fluoro-2,3-dimethylhept-6-ene-1-thiol (CID 163638496) is (2R)-1-fluoro-2,3-dimethylhept-6-ene-1-thiol.
What is the SMILES notation for (2R)-1-fluoro-2,3-dimethylhept-6-ene-1-thiol?
The canonical SMILES for (2R)-1-fluoro-2,3-dimethylhept-6-ene-1-thiol is C=CCCC(C)[C@@H](C)C(F)S.
What is the InChIKey of (2R)-1-fluoro-2,3-dimethylhept-6-ene-1-thiol?
The InChIKey is ICFZFOVFTUFNGO-QJAFJHJLSA-N. The full InChI is InChI=1S/C9H17FS/c1-4-5-6-7(2)8(3)9(10)11/h4,7-9,11H,1,5-6H2,2-3H3/t7?,8-,9?/m1/s1.
What are the key properties of (2R)-1-fluoro-2,3-dimethylhept-6-ene-1-thiol?
(2R)-1-fluoro-2,3-dimethylhept-6-ene-1-thiol has a molecular weight of 176.30 g/mol, XLogP of 3.45, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-fluoro-2,3-dimethylhept-6-ene-1-thiol is sourced from PubChem (CID 163638496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).