C10H19NO2 — CID 163639655
(3E,5E)-3,6-dimethoxyocta-3,5-dien-4-amine (PubChem CID 163639655) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is (3E,5E)-3,6-dimethoxyocta-3,5-dien-4-amine.
| Compound Name | (3E,5E)-3,6-dimethoxyocta-3,5-dien-4-amine |
|---|---|
| PubChem CID | 163639655 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | (3E,5E)-3,6-dimethoxyocta-3,5-dien-4-amine |
| SMILES | CC/C(=C\C(N)=C(\CC)OC)OC |
| InChI | InChI=1S/C10H19NO2/c1-5-8(12-3)7-9(11)10(6-2)13-4/h7H,5-6,11H2,1-4H3/b8-7+,10-9+ |
| InChIKey | IDDNPWNMHQDFLO-XBLVEGMJSA-N |
| XLogP | 2.15 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|