C15H32N2O3 — CID 163640751
4-amino-4-methyl-1-[2-[4-(propan-2-ylamino)butan-2-yloxy]ethoxy]pentan-3-one (PubChem CID 163640751) has the molecular formula C15H32N2O3 and a molecular weight of 288.43 g/mol. Its IUPAC name is 4-amino-4-methyl-1-[2-[4-(propan-2-ylamino)butan-2-yloxy]ethoxy]pentan-3-one.
| Compound Name | 4-amino-4-methyl-1-[2-[4-(propan-2-ylamino)butan-2-yloxy]ethoxy]pentan-3-one |
|---|---|
| PubChem CID | 163640751 |
| Molecular Formula | C15H32N2O3 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.24 |
| IUPAC Name | 4-amino-4-methyl-1-[2-[4-(propan-2-ylamino)butan-2-yloxy]ethoxy]pentan-3-one |
| SMILES | CC(C)NCCC(C)OCCOCCC(=O)C(C)(C)N |
| InChI | InChI=1S/C15H32N2O3/c1-12(2)17-8-6-13(3)20-11-10-19-9-7-14(18)15(4,5)16/h12-13,17H,6-11,16H2,1-5H3 |
| InChIKey | IEAVQNNNAMFCGW-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|