About (2E)-5-methyl-3-(trifluoromethyl)hexa-2,5-dien-1-amine
(2E)-5-methyl-3-(trifluoromethyl)hexa-2,5-dien-1-amine (PubChem CID 163641398) has the molecular formula C8H12F3N
and a molecular weight of 179.18 g/mol. Its IUPAC name is (2E)-5-methyl-3-(trifluoromethyl)hexa-2,5-dien-1-amine.
Molecular Properties
| Compound Name | (2E)-5-methyl-3-(trifluoromethyl)hexa-2,5-dien-1-amine |
| PubChem CID | 163641398 |
| Molecular Formula | C8H12F3N |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (2E)-5-methyl-3-(trifluoromethyl)hexa-2,5-dien-1-amine |
| SMILES | C=C(C)C/C(=C\CN)C(F)(F)F |
| InChI | InChI=1S/C8H12F3N/c1-6(2)5-7(3-4-12)8(9,10)11/h3H,1,4-5,12H2,2H3/b7-3+ |
| InChIKey | IEOIPKCMEQYMTM-XVNBXDOJSA-N |
| XLogP | 2.40 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-5-methyl-3-(trifluoromethyl)hexa-2,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-5-methyl-3-(trifluoromethyl)hexa-2,5-dien-1-amine?
The IUPAC name of (2E)-5-methyl-3-(trifluoromethyl)hexa-2,5-dien-1-amine (CID 163641398) is (2E)-5-methyl-3-(trifluoromethyl)hexa-2,5-dien-1-amine.
What is the SMILES notation for (2E)-5-methyl-3-(trifluoromethyl)hexa-2,5-dien-1-amine?
The canonical SMILES for (2E)-5-methyl-3-(trifluoromethyl)hexa-2,5-dien-1-amine is C=C(C)C/C(=C\CN)C(F)(F)F.
What is the InChIKey of (2E)-5-methyl-3-(trifluoromethyl)hexa-2,5-dien-1-amine?
The InChIKey is IEOIPKCMEQYMTM-XVNBXDOJSA-N. The full InChI is InChI=1S/C8H12F3N/c1-6(2)5-7(3-4-12)8(9,10)11/h3H,1,4-5,12H2,2H3/b7-3+.
What are the key properties of (2E)-5-methyl-3-(trifluoromethyl)hexa-2,5-dien-1-amine?
(2E)-5-methyl-3-(trifluoromethyl)hexa-2,5-dien-1-amine has a molecular weight of 179.18 g/mol, XLogP of 2.40, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-5-methyl-3-(trifluoromethyl)hexa-2,5-dien-1-amine is sourced from PubChem (CID 163641398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).