C15H13NO6S — CID 163642514
2-[[2-(benzenesulfonyloxy)acetyl]amino]benzoic acid (PubChem CID 163642514) has the molecular formula C15H13NO6S and a molecular weight of 335.34 g/mol. Its IUPAC name is 2-[[2-(benzenesulfonyloxy)acetyl]amino]benzoic acid.
| Compound Name | 2-[[2-(benzenesulfonyloxy)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 163642514 |
| Molecular Formula | C15H13NO6S |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 2-[[2-(benzenesulfonyloxy)acetyl]amino]benzoic acid |
| SMILES | O=C(COS(=O)(=O)c1ccccc1)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C15H13NO6S/c17-14(16-13-9-5-4-8-12(13)15(18)19)10-22-23(20,21)11-6-2-1-3-7-11/h1-9H,10H2,(H,16,17)(H,18,19) |
| InChIKey | IFMBPNJAFSONCQ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|