C13H11N3O5 — CID 43353075
2-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]benzoic acid (PubChem CID 43353075) has the molecular formula C13H11N3O5 and a molecular weight of 289.25 g/mol. Its IUPAC name is 2-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]benzoic acid.
| Compound Name | 2-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 43353075 |
| Molecular Formula | C13H11N3O5 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 2-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]benzoic acid |
| SMILES | O=C(Cc1cc(=O)[nH]c(=O)[nH]1)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C13H11N3O5/c17-10(5-7-6-11(18)16-13(21)14-7)15-9-4-2-1-3-8(9)12(19)20/h1-4,6H,5H2,(H,15,17)(H,19,20)(H2,14,16,18,21) |
| InChIKey | GMBIENPGHPKTLW-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 132.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |