C31H24F3N7O3 — CID 163644668
[2-[[8-(2,6-difluorophenyl)-4-(4-fluoro-2-methylphenyl)-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]ethylamino] N-cyano-2-phenoxyethanimidate (PubChem CID 163644668) has the molecular formula C31H24F3N7O3 and a molecular weight of 599.57 g/mol. Its IUPAC name is [2-[[8-(2,6-difluorophenyl)-4-(4-fluoro-2-methylphenyl)-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]ethylamino] N-cyano-2-phenoxyethanimidate.
| Compound Name | [2-[[8-(2,6-difluorophenyl)-4-(4-fluoro-2-methylphenyl)-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]ethylamino] N-cyano-2-phenoxyethanimidate |
|---|---|
| PubChem CID | 163644668 |
| Molecular Formula | C31H24F3N7O3 |
| Molecular Weight | 599.57 g/mol |
| Exact Mass | 599.19 |
| IUPAC Name | [2-[[8-(2,6-difluorophenyl)-4-(4-fluoro-2-methylphenyl)-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]ethylamino] N-cyano-2-phenoxyethanimidate |
| SMILES | Cc1cc(F)ccc1-c1nc(NCCNO/C(COc2ccccc2)=N/C#N)nc2c1ccc(=O)n2-c1c(F)cccc1F |
| InChI | InChI=1S/C31H24F3N7O3/c1-19-16-20(32)10-11-22(19)28-23-12-13-27(42)41(29-24(33)8-5-9-25(29)34)30(23)40-31(39-28)36-14-15-38-44-26(37-18-35)17-43-21-6-3-2-4-7-21/h2-13,16,38H,14-15,17H2,1H3,(H,36,39,40)/b37-26+ |
| InChIKey | IHFWIPKSXNOKDJ-AVLPFNLUSA-N |
| XLogP | 5.07 |
| TPSA | 126.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.57 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|