C24H21F3N6O2 — CID 59639510
1-[2-[[8-(2,6-difluorophenyl)-4-(4-fluoro-2-methylphenyl)-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]ethyl]-3-methylurea (PubChem CID 59639510) has the molecular formula C24H21F3N6O2 and a molecular weight of 482.47 g/mol. Its IUPAC name is 1-[2-[[8-(2,6-difluorophenyl)-4-(4-fluoro-2-methylphenyl)-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]ethyl]-3-methylurea.
| Compound Name | 1-[2-[[8-(2,6-difluorophenyl)-4-(4-fluoro-2-methylphenyl)-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]ethyl]-3-methylurea |
|---|---|
| PubChem CID | 59639510 |
| Molecular Formula | C24H21F3N6O2 |
| Molecular Weight | 482.47 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 1-[2-[[8-(2,6-difluorophenyl)-4-(4-fluoro-2-methylphenyl)-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]ethyl]-3-methylurea |
| SMILES | CNC(=O)NCCNc1nc(-c2ccc(F)cc2C)c2ccc(=O)n(-c3c(F)cccc3F)c2n1 |
| InChI | InChI=1S/C24H21F3N6O2/c1-13-12-14(25)6-7-15(13)20-16-8-9-19(34)33(21-17(26)4-3-5-18(21)27)22(16)32-23(31-20)29-10-11-30-24(35)28-2/h3-9,12H,10-11H2,1-2H3,(H2,28,30,35)(H,29,31,32) |
| InChIKey | PEBARNOEEPAFQA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|