C32H27F3N4O2 — CID 58154504
8-(2,6-difluorophenyl)-4-(4-fluoro-2-methylphenyl)-2-[[5-(3-methylphenyl)-4-oxopentyl]amino]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 58154504) has the molecular formula C32H27F3N4O2 and a molecular weight of 556.59 g/mol. Its IUPAC name is 8-(2,6-difluorophenyl)-4-(4-fluoro-2-methylphenyl)-2-[[5-(3-methylphenyl)-4-oxopentyl]amino]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-(2,6-difluorophenyl)-4-(4-fluoro-2-methylphenyl)-2-[[5-(3-methylphenyl)-4-oxopentyl]amino]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 58154504 |
| Molecular Formula | C32H27F3N4O2 |
| Molecular Weight | 556.59 g/mol |
| Exact Mass | 556.21 |
| IUPAC Name | 8-(2,6-difluorophenyl)-4-(4-fluoro-2-methylphenyl)-2-[[5-(3-methylphenyl)-4-oxopentyl]amino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cc1cccc(CC(=O)CCCNc2nc(-c3ccc(F)cc3C)c3ccc(=O)n(-c4c(F)cccc4F)c3n2)c1 |
| InChI | InChI=1S/C32H27F3N4O2/c1-19-6-3-7-21(16-19)18-23(40)8-5-15-36-32-37-29(24-12-11-22(33)17-20(24)2)25-13-14-28(41)39(31(25)38-32)30-26(34)9-4-10-27(30)35/h3-4,6-7,9-14,16-17H,5,8,15,18H2,1-2H3,(H,36,37,38) |
| InChIKey | RCAOWBVTRAHBNA-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.59 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|