C27H25FN4O3S — CID 163644939
5-fluoro-N-[1-[2-(2-iminoethyl)phenyl]propyl]-2-(quinolin-8-ylsulfonylamino)benzamide (PubChem CID 163644939) has the molecular formula C27H25FN4O3S and a molecular weight of 504.59 g/mol. Its IUPAC name is 5-fluoro-N-[1-[2-(2-iminoethyl)phenyl]propyl]-2-(quinolin-8-ylsulfonylamino)benzamide.
| Compound Name | 5-fluoro-N-[1-[2-(2-iminoethyl)phenyl]propyl]-2-(quinolin-8-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 163644939 |
| Molecular Formula | C27H25FN4O3S |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | 5-fluoro-N-[1-[2-(2-iminoethyl)phenyl]propyl]-2-(quinolin-8-ylsulfonylamino)benzamide |
| SMILES | [H]/N=C/Cc1ccccc1C(CC)NC(=O)c1cc(F)ccc1NS(=O)(=O)c1cccc2cccnc12 |
| InChI | InChI=1S/C27H25FN4O3S/c1-2-23(21-10-4-3-7-18(21)14-15-29)31-27(33)22-17-20(28)12-13-24(22)32-36(34,35)25-11-5-8-19-9-6-16-30-26(19)25/h3-13,15-17,23,29,32H,2,14H2,1H3,(H,31,33)/b29-15+ |
| InChIKey | IHLDEZFDFPJVCA-WKULSOCRSA-N |
| XLogP | 5.25 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|