C14H18F3N3 — CID 163646793
2,4-difluoro-5-(5-fluoro-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridin-3-yl)-6-methylidenecyclohexa-2,4-dien-1-amine (PubChem CID 163646793) has the molecular formula C14H18F3N3 and a molecular weight of 285.31 g/mol. Its IUPAC name is 2,4-difluoro-5-(5-fluoro-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridin-3-yl)-6-methylidenecyclohexa-2,4-dien-1-amine.
| Compound Name | 2,4-difluoro-5-(5-fluoro-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridin-3-yl)-6-methylidenecyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 163646793 |
| Molecular Formula | C14H18F3N3 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 2,4-difluoro-5-(5-fluoro-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridin-3-yl)-6-methylidenecyclohexa-2,4-dien-1-amine |
| SMILES | C=C1C(C2CNC3NCC(F)CC32)=C(F)C=C(F)C1N |
| InChI | InChI=1S/C14H18F3N3/c1-6-12(10(16)3-11(17)13(6)18)9-5-20-14-8(9)2-7(15)4-19-14/h3,7-9,13-14,19-20H,1-2,4-5,18H2 |
| InChIKey | IIXDOFQQAAEOGQ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |