C19H29F2N3 — CID 139453699
(6S)-2-fluoro-6-[6-(4-fluoro-5-methylcyclohex-2-en-1-yl)-1,2,3,6-tetrahydropyridin-5-yl]-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridine (PubChem CID 139453699) has the molecular formula C19H29F2N3 and a molecular weight of 337.46 g/mol. Its IUPAC name is (6S)-2-fluoro-6-[6-(4-fluoro-5-methylcyclohex-2-en-1-yl)-1,2,3,6-tetrahydropyridin-5-yl]-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridine.
| Compound Name | (6S)-2-fluoro-6-[6-(4-fluoro-5-methylcyclohex-2-en-1-yl)-1,2,3,6-tetrahydropyridin-5-yl]-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 139453699 |
| Molecular Formula | C19H29F2N3 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | (6S)-2-fluoro-6-[6-(4-fluoro-5-methylcyclohex-2-en-1-yl)-1,2,3,6-tetrahydropyridin-5-yl]-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyridine |
| SMILES | CC1CC(C2NCCC=C2[C@@H]2CCC3NC(F)CN3C2)C=CC1F |
| InChI | InChI=1S/C19H29F2N3/c1-12-9-13(4-6-16(12)20)19-15(3-2-8-22-19)14-5-7-18-23-17(21)11-24(18)10-14/h3-4,6,12-14,16-19,22-23H,2,5,7-11H2,1H3/t12?,13?,14-,16?,17?,18?,19?/m1/s1 |
| InChIKey | VAEOQKLYPMRBII-YQEVFSEFSA-N |
| XLogP | 2.76 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|