C11H18N2 — CID 166611130
2,3,5,6,7,7a,8,9-octahydro-1H-imidazo[2,1-j]quinoline (PubChem CID 166611130) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 2,3,5,6,7,7a,8,9-octahydro-1H-imidazo[2,1-j]quinoline.
| Compound Name | 2,3,5,6,7,7a,8,9-octahydro-1H-imidazo[2,1-j]quinoline |
|---|---|
| PubChem CID | 166611130 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 2,3,5,6,7,7a,8,9-octahydro-1H-imidazo[2,1-j]quinoline |
| SMILES | C1=CC23NCCN2CCCC3CC1 |
| InChI | InChI=1S/C11H18N2/c1-2-6-11-10(4-1)5-3-8-13(11)9-7-12-11/h2,6,10,12H,1,3-5,7-9H2 |
| InChIKey | ULMZONALLAOWHK-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|