C15H25N3 — CID 148868837
(3aS,7aS)-6-(2-cyclohexa-2,4-dien-1-ylethyl)-2,3,3a,4,5,7-hexahydro-1H-pyrrolo[2,3-c]pyridin-7a-amine (PubChem CID 148868837) has the molecular formula C15H25N3 and a molecular weight of 247.39 g/mol. Its IUPAC name is (3aS,7aS)-6-(2-cyclohexa-2,4-dien-1-ylethyl)-2,3,3a,4,5,7-hexahydro-1H-pyrrolo[2,3-c]pyridin-7a-amine.
| Compound Name | (3aS,7aS)-6-(2-cyclohexa-2,4-dien-1-ylethyl)-2,3,3a,4,5,7-hexahydro-1H-pyrrolo[2,3-c]pyridin-7a-amine |
|---|---|
| PubChem CID | 148868837 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | (3aS,7aS)-6-(2-cyclohexa-2,4-dien-1-ylethyl)-2,3,3a,4,5,7-hexahydro-1H-pyrrolo[2,3-c]pyridin-7a-amine |
| SMILES | N[C@@]12CN(CCC3C=CC=CC3)CC[C@@H]1CCN2 |
| InChI | InChI=1S/C15H25N3/c16-15-12-18(11-8-14(15)6-9-17-15)10-7-13-4-2-1-3-5-13/h1-4,13-14,17H,5-12,16H2/t13?,14-,15+/m0/s1 |
| InChIKey | PATINBYOBGMDJO-NOYMGPGASA-N |
| XLogP | 1.48 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |