C22H32N2 — CID 138615286
12-butan-2-yl-2,5,7-trimethyl-1,2,3,8,8a,12,12a,12b-octahydroimidazo[1,2-f]phenanthridine (PubChem CID 138615286) has the molecular formula C22H32N2 and a molecular weight of 324.51 g/mol. Its IUPAC name is 12-butan-2-yl-2,5,7-trimethyl-1,2,3,8,8a,12,12a,12b-octahydroimidazo[1,2-f]phenanthridine.
| Compound Name | 12-butan-2-yl-2,5,7-trimethyl-1,2,3,8,8a,12,12a,12b-octahydroimidazo[1,2-f]phenanthridine |
|---|---|
| PubChem CID | 138615286 |
| Molecular Formula | C22H32N2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.26 |
| IUPAC Name | 12-butan-2-yl-2,5,7-trimethyl-1,2,3,8,8a,12,12a,12b-octahydroimidazo[1,2-f]phenanthridine |
| SMILES | CCC(C)C1C=CC=C2C3CC(C)=CC(C)=C3N3CC(C)NC3C21 |
| InChI | InChI=1S/C22H32N2/c1-6-14(3)17-8-7-9-18-19-11-13(2)10-15(4)21(19)24-12-16(5)23-22(24)20(17)18/h7-10,14,16-17,19-20,22-23H,6,11-12H2,1-5H3 |
| InChIKey | PSCKTOLQHYOIII-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |