C15H29N3 — CID 176569702
(Z)-N,4-dimethyl-2-(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridin-3-yl)pent-2-en-1-amine (PubChem CID 176569702) has the molecular formula C15H29N3 and a molecular weight of 251.42 g/mol. Its IUPAC name is (Z)-N,4-dimethyl-2-(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridin-3-yl)pent-2-en-1-amine.
| Compound Name | (Z)-N,4-dimethyl-2-(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridin-3-yl)pent-2-en-1-amine |
|---|---|
| PubChem CID | 176569702 |
| Molecular Formula | C15H29N3 |
| Molecular Weight | 251.42 g/mol |
| Exact Mass | 251.24 |
| IUPAC Name | (Z)-N,4-dimethyl-2-(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridin-3-yl)pent-2-en-1-amine |
| SMILES | CNC/C(=C\C(C)C)C1CNC2NCC(C)CC21 |
| InChI | InChI=1S/C15H29N3/c1-10(2)5-12(8-16-4)14-9-18-15-13(14)6-11(3)7-17-15/h5,10-11,13-18H,6-9H2,1-4H3/b12-5+ |
| InChIKey | YZIYBUHGYPEWMH-LFYBBSHMSA-N |
| XLogP | 1.58 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.42 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|