C30H30ClN8O6- — CID 163650182
N-[2-[2-chloro-4-[hydroxy(oxido)amino]-5-[[4-(2-oxopyrrolidin-1-yl)benzoyl]amino]anilino]ethyl]-5-(2-methoxyphenyl)-3-methyltriazole-4-carboxamide (PubChem CID 163650182) has the molecular formula C30H30ClN8O6- and a molecular weight of 634.07 g/mol. Its IUPAC name is N-[2-[2-chloro-4-[hydroxy(oxido)amino]-5-[[4-(2-oxopyrrolidin-1-yl)benzoyl]amino]anilino]ethyl]-5-(2-methoxyphenyl)-3-methyltriazole-4-carboxamide.
| Compound Name | N-[2-[2-chloro-4-[hydroxy(oxido)amino]-5-[[4-(2-oxopyrrolidin-1-yl)benzoyl]amino]anilino]ethyl]-5-(2-methoxyphenyl)-3-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 163650182 |
| Molecular Formula | C30H30ClN8O6- |
| Molecular Weight | 634.07 g/mol |
| Exact Mass | 633.20 |
| IUPAC Name | N-[2-[2-chloro-4-[hydroxy(oxido)amino]-5-[[4-(2-oxopyrrolidin-1-yl)benzoyl]amino]anilino]ethyl]-5-(2-methoxyphenyl)-3-methyltriazole-4-carboxamide |
| SMILES | COc1ccccc1-c1nnn(C)c1C(=O)NCCNc1cc(NC(=O)c2ccc(N3CCCC3=O)cc2)c(N([O-])O)cc1Cl |
| InChI | InChI=1S/C30H30ClN8O6/c1-37-28(27(35-36-37)20-6-3-4-7-25(20)45-2)30(42)33-14-13-32-22-17-23(24(39(43)44)16-21(22)31)34-29(41)18-9-11-19(12-10-18)38-15-5-8-26(38)40/h3-4,6-7,9-12,16-17,32,43H,5,8,13-15H2,1-2H3,(H,33,42)(H,34,41)/q-1 |
| InChIKey | GABSVWKEBKWSQF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 177.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.07 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|