C31H33ClN6O6 — CID 163523973
N-[2-[2-chloro-4-nitro-5-[(4-pyrrolidin-1-ylbenzoyl)amino]anilino]ethyl]-3-(2-methoxyphenyl)-5-methyl-4,5-dihydro-1,2-oxazole-4-carboxamide (PubChem CID 163523973) has the molecular formula C31H33ClN6O6 and a molecular weight of 621.09 g/mol. Its IUPAC name is N-[2-[2-chloro-4-nitro-5-[(4-pyrrolidin-1-ylbenzoyl)amino]anilino]ethyl]-3-(2-methoxyphenyl)-5-methyl-4,5-dihydro-1,2-oxazole-4-carboxamide.
| Compound Name | N-[2-[2-chloro-4-nitro-5-[(4-pyrrolidin-1-ylbenzoyl)amino]anilino]ethyl]-3-(2-methoxyphenyl)-5-methyl-4,5-dihydro-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 163523973 |
| Molecular Formula | C31H33ClN6O6 |
| Molecular Weight | 621.09 g/mol |
| Exact Mass | 620.22 |
| IUPAC Name | N-[2-[2-chloro-4-nitro-5-[(4-pyrrolidin-1-ylbenzoyl)amino]anilino]ethyl]-3-(2-methoxyphenyl)-5-methyl-4,5-dihydro-1,2-oxazole-4-carboxamide |
| SMILES | COc1ccccc1C1=NOC(C)C1C(=O)NCCNc1cc(NC(=O)c2ccc(N3CCCC3)cc2)c([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C31H33ClN6O6/c1-19-28(29(36-44-19)22-7-3-4-8-27(22)43-2)31(40)34-14-13-33-24-18-25(26(38(41)42)17-23(24)32)35-30(39)20-9-11-21(12-10-20)37-15-5-6-16-37/h3-4,7-12,17-19,28,33H,5-6,13-16H2,1-2H3,(H,34,40)(H,35,39) |
| InChIKey | DNDQPLOEPKBULA-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.09 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|