C22H15F2O4S+ — CID 163650936
[3-[(Z)-3-carboxy-2,3-difluoroprop-2-enoyl]oxyphenyl]-diphenylsulfanium (PubChem CID 163650936) has the molecular formula C22H15F2O4S+ and a molecular weight of 413.42 g/mol. Its IUPAC name is [3-[(Z)-3-carboxy-2,3-difluoroprop-2-enoyl]oxyphenyl]-diphenylsulfanium.
| Compound Name | [3-[(Z)-3-carboxy-2,3-difluoroprop-2-enoyl]oxyphenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 163650936 |
| Molecular Formula | C22H15F2O4S+ |
| Molecular Weight | 413.42 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | [3-[(Z)-3-carboxy-2,3-difluoroprop-2-enoyl]oxyphenyl]-diphenylsulfanium |
| SMILES | O=C(O)/C(F)=C(/F)C(=O)Oc1cccc([S+](c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C22H14F2O4S/c23-19(21(25)26)20(24)22(27)28-15-8-7-13-18(14-15)29(16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-14H/p+1/b20-19- |
| InChIKey | IMEIZKGXWQMVNR-VXPUYCOJSA-O |
| XLogP | 4.92 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.42 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|