C13H18FNO2S — CID 163651964
N-[(1R,2S)-1-(4-ethylsulfinylphenyl)-3-fluoro-1-methoxypropan-2-yl]methanimine (PubChem CID 163651964) has the molecular formula C13H18FNO2S and a molecular weight of 271.36 g/mol. Its IUPAC name is N-[(1R,2S)-1-(4-ethylsulfinylphenyl)-3-fluoro-1-methoxypropan-2-yl]methanimine.
| Compound Name | N-[(1R,2S)-1-(4-ethylsulfinylphenyl)-3-fluoro-1-methoxypropan-2-yl]methanimine |
|---|---|
| PubChem CID | 163651964 |
| Molecular Formula | C13H18FNO2S |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | N-[(1R,2S)-1-(4-ethylsulfinylphenyl)-3-fluoro-1-methoxypropan-2-yl]methanimine |
| SMILES | C=N[C@H](CF)[C@H](OC)c1ccc(S(=O)CC)cc1 |
| InChI | InChI=1S/C13H18FNO2S/c1-4-18(16)11-7-5-10(6-8-11)13(17-3)12(9-14)15-2/h5-8,12-13H,2,4,9H2,1,3H3/t12-,13-,18?/m1/s1 |
| InChIKey | IMYUNYOLMDZDJJ-KDLOSYIVSA-N |
| XLogP | 2.54 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|