C18H34 — CID 163653871
1-(3-ethyl-2,3-dimethylpent-4-en-2-yl)-4-propylcyclohexane (PubChem CID 163653871) has the molecular formula C18H34 and a molecular weight of 250.47 g/mol. Its IUPAC name is 1-(3-ethyl-2,3-dimethylpent-4-en-2-yl)-4-propylcyclohexane.
| Compound Name | 1-(3-ethyl-2,3-dimethylpent-4-en-2-yl)-4-propylcyclohexane |
|---|---|
| PubChem CID | 163653871 |
| Molecular Formula | C18H34 |
| Molecular Weight | 250.47 g/mol |
| Exact Mass | 250.27 |
| IUPAC Name | 1-(3-ethyl-2,3-dimethylpent-4-en-2-yl)-4-propylcyclohexane |
| SMILES | C=CC(C)(CC)C(C)(C)C1CCC(CCC)CC1 |
| InChI | InChI=1S/C18H34/c1-7-10-15-11-13-16(14-12-15)17(4,5)18(6,8-2)9-3/h8,15-16H,2,7,9-14H2,1,3-6H3 |
| InChIKey | IONDXDOPBQBTOT-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.47 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|