C16H21N3O2 — CID 163655247
5-ethyl-4-hydroxy-5-methyl-3-[C-methyl-N-(4-methylanilino)carbonimidoyl]-1H-pyrrol-2-one (PubChem CID 163655247) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 5-ethyl-4-hydroxy-5-methyl-3-[C-methyl-N-(4-methylanilino)carbonimidoyl]-1H-pyrrol-2-one.
| Compound Name | 5-ethyl-4-hydroxy-5-methyl-3-[C-methyl-N-(4-methylanilino)carbonimidoyl]-1H-pyrrol-2-one |
|---|---|
| PubChem CID | 163655247 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 5-ethyl-4-hydroxy-5-methyl-3-[C-methyl-N-(4-methylanilino)carbonimidoyl]-1H-pyrrol-2-one |
| SMILES | CCC1(C)NC(=O)C(C(C)=NNc2ccc(C)cc2)=C1O |
| InChI | InChI=1S/C16H21N3O2/c1-5-16(4)14(20)13(15(21)17-16)11(3)18-19-12-8-6-10(2)7-9-12/h6-9,19-20H,5H2,1-4H3,(H,17,21) |
| InChIKey | DBCUGYMTQAYULR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_enamin(30)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|