C20H17N2O4S2- — CID 8826589
5-[(Z)-C-methyl-N-[4-(4-methylphenyl)sulfonylanilino]carbonimidoyl]thiophene-2-carboxylate (PubChem CID 8826589) has the molecular formula C20H17N2O4S2- and a molecular weight of 413.50 g/mol. Its IUPAC name is 5-[(Z)-C-methyl-N-[4-(4-methylphenyl)sulfonylanilino]carbonimidoyl]thiophene-2-carboxylate.
| Compound Name | 5-[(Z)-C-methyl-N-[4-(4-methylphenyl)sulfonylanilino]carbonimidoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 8826589 |
| Molecular Formula | C20H17N2O4S2- |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | 5-[(Z)-C-methyl-N-[4-(4-methylphenyl)sulfonylanilino]carbonimidoyl]thiophene-2-carboxylate |
| SMILES | C/C(=N/Nc1ccc(S(=O)(=O)c2ccc(C)cc2)cc1)c1ccc(C(=O)[O-])s1 |
| InChI | InChI=1S/C20H18N2O4S2/c1-13-3-7-16(8-4-13)28(25,26)17-9-5-15(6-10-17)22-21-14(2)18-11-12-19(27-18)20(23)24/h3-12,22H,1-2H3,(H,23,24)/p-1/b21-14- |
| InChIKey | FDSVFSBTUIGKAD-STZFKDTASA-M |
| XLogP | 3.09 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|