C33H39N5O4 — CID 163656818
N-[(2S)-1-[[(3aR,5S)-7-(benzylamino)-6-hydroxy-3-oxo-1,2,3a,4,5,6-hexahydroisoindol-5-yl]amino]-3-cyclohexyl-1-oxopropan-2-yl]-1H-indole-2-carboxamide (PubChem CID 163656818) has the molecular formula C33H39N5O4 and a molecular weight of 569.71 g/mol. Its IUPAC name is N-[(2S)-1-[[(3aR,5S)-7-(benzylamino)-6-hydroxy-3-oxo-1,2,3a,4,5,6-hexahydroisoindol-5-yl]amino]-3-cyclohexyl-1-oxopropan-2-yl]-1H-indole-2-carboxamide.
| Compound Name | N-[(2S)-1-[[(3aR,5S)-7-(benzylamino)-6-hydroxy-3-oxo-1,2,3a,4,5,6-hexahydroisoindol-5-yl]amino]-3-cyclohexyl-1-oxopropan-2-yl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 163656818 |
| Molecular Formula | C33H39N5O4 |
| Molecular Weight | 569.71 g/mol |
| Exact Mass | 569.30 |
| IUPAC Name | N-[(2S)-1-[[(3aR,5S)-7-(benzylamino)-6-hydroxy-3-oxo-1,2,3a,4,5,6-hexahydroisoindol-5-yl]amino]-3-cyclohexyl-1-oxopropan-2-yl]-1H-indole-2-carboxamide |
| SMILES | O=C(N[C@@H](CC1CCCCC1)C(=O)N[C@H]1C[C@H]2C(=O)NCC2=C(NCc2ccccc2)C1O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C33H39N5O4/c39-30-26(17-23-24(19-35-31(23)40)29(30)34-18-21-11-5-2-6-12-21)37-32(41)27(15-20-9-3-1-4-10-20)38-33(42)28-16-22-13-7-8-14-25(22)36-28/h2,5-8,11-14,16,20,23,26-27,30,34,36,39H,1,3-4,9-10,15,17-19H2,(H,35,40)(H,37,41)(H,38,42)/t23-,26+,27+,30?/m1/s1 |
| InChIKey | IQYAHFMSHPUFFT-SNDDHDFISA-N |
| XLogP | 3.28 |
| TPSA | 135.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.71 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |