C9H16F3NO2S — CID 163658616
N-(cycloheptylmethyl)-1,1,1-trifluoromethanesulfonamide (PubChem CID 163658616) has the molecular formula C9H16F3NO2S and a molecular weight of 259.29 g/mol. Its IUPAC name is N-(cycloheptylmethyl)-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-(cycloheptylmethyl)-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 163658616 |
| Molecular Formula | C9H16F3NO2S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | N-(cycloheptylmethyl)-1,1,1-trifluoromethanesulfonamide |
| SMILES | O=S(=O)(NCC1CCCCCC1)C(F)(F)F |
| InChI | InChI=1S/C9H16F3NO2S/c10-9(11,12)16(14,15)13-7-8-5-3-1-2-4-6-8/h8,13H,1-7H2 |
| InChIKey | ISKMQRPXFSZUNC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |