C22H21N3O3 — CID 163661075
[2-(1-benzofuran-3-yl)-3-[(2S)-2-methylpyrrolidin-1-yl]quinoxalin-6-yl]methanediol (PubChem CID 163661075) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is [2-(1-benzofuran-3-yl)-3-[(2S)-2-methylpyrrolidin-1-yl]quinoxalin-6-yl]methanediol.
| Compound Name | [2-(1-benzofuran-3-yl)-3-[(2S)-2-methylpyrrolidin-1-yl]quinoxalin-6-yl]methanediol |
|---|---|
| PubChem CID | 163661075 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | [2-(1-benzofuran-3-yl)-3-[(2S)-2-methylpyrrolidin-1-yl]quinoxalin-6-yl]methanediol |
| SMILES | C[C@H]1CCCN1c1nc2cc(C(O)O)ccc2nc1-c1coc2ccccc12 |
| InChI | InChI=1S/C22H21N3O3/c1-13-5-4-10-25(13)21-20(16-12-28-19-7-3-2-6-15(16)19)23-17-9-8-14(22(26)27)11-18(17)24-21/h2-3,6-9,11-13,22,26-27H,4-5,10H2,1H3/t13-/m0/s1 |
| InChIKey | IUKQHSZWQRQJRU-ZDUSSCGKSA-N |
| XLogP | 4.01 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|