C13H16N2O — CID 54476085
3-(2-methylpiperidin-1-yl)-1,2-benzoxazole (PubChem CID 54476085) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 3-(2-methylpiperidin-1-yl)-1,2-benzoxazole.
| Compound Name | 3-(2-methylpiperidin-1-yl)-1,2-benzoxazole |
|---|---|
| PubChem CID | 54476085 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 3-(2-methylpiperidin-1-yl)-1,2-benzoxazole |
| SMILES | CC1CCCCN1c1noc2ccccc12 |
| InChI | InChI=1S/C13H16N2O/c1-10-6-4-5-9-15(10)13-11-7-2-3-8-12(11)16-14-13/h2-3,7-8,10H,4-6,9H2,1H3 |
| InChIKey | XLRAIWMJVPEZHL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |