C11H24N3+ — CID 163662683
[amino-(3,4,4-trimethylhex-2-enylamino)methylidene]-methylazanium (PubChem CID 163662683) has the molecular formula C11H24N3+ and a molecular weight of 198.33 g/mol. Its IUPAC name is [amino-(3,4,4-trimethylhex-2-enylamino)methylidene]-methylazanium.
| Compound Name | [amino-(3,4,4-trimethylhex-2-enylamino)methylidene]-methylazanium |
|---|---|
| PubChem CID | 163662683 |
| Molecular Formula | C11H24N3+ |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.20 |
| IUPAC Name | [amino-(3,4,4-trimethylhex-2-enylamino)methylidene]-methylazanium |
| SMILES | CCC(C)(C)C(C)=CCN/C(N)=[NH+]/C |
| InChI | InChI=1S/C11H23N3/c1-6-11(3,4)9(2)7-8-14-10(12)13-5/h7H,6,8H2,1-5H3,(H3,12,13,14)/p+1 |
| InChIKey | IVTBXYATFKNQNY-UHFFFAOYSA-O |
| XLogP | -0.02 |
| TPSA | 52.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|