C11H23N3 — CID 163662684
2-methyl-1-(3,4,4-trimethylhex-2-enyl)guanidine (PubChem CID 163662684) has the molecular formula C11H23N3 and a molecular weight of 197.33 g/mol. Its IUPAC name is 2-methyl-1-(3,4,4-trimethylhex-2-enyl)guanidine.
| Compound Name | 2-methyl-1-(3,4,4-trimethylhex-2-enyl)guanidine |
|---|---|
| PubChem CID | 163662684 |
| Molecular Formula | C11H23N3 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.19 |
| IUPAC Name | 2-methyl-1-(3,4,4-trimethylhex-2-enyl)guanidine |
| SMILES | CCC(C)(C)C(C)=CCN/C(N)=N/C |
| InChI | InChI=1S/C11H23N3/c1-6-11(3,4)9(2)7-8-14-10(12)13-5/h7H,6,8H2,1-5H3,(H3,12,13,14) |
| InChIKey | IVTBXYATFKNQNY-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|