C31H53N3 — CID 132606932
1,2-bis[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]guanidine (PubChem CID 132606932) has the molecular formula C31H53N3 and a molecular weight of 467.79 g/mol. Its IUPAC name is 1,2-bis[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]guanidine.
| Compound Name | 1,2-bis[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]guanidine |
|---|---|
| PubChem CID | 132606932 |
| Molecular Formula | C31H53N3 |
| Molecular Weight | 467.79 g/mol |
| Exact Mass | 467.42 |
| IUPAC Name | 1,2-bis[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]guanidine |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C/N=C(\N)NC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C31H53N3/c1-25(2)13-9-15-27(5)17-11-19-29(7)21-23-33-31(32)34-24-22-30(8)20-12-18-28(6)16-10-14-26(3)4/h13-14,17-18,21-22H,9-12,15-16,19-20,23-24H2,1-8H3,(H3,32,33,34)/b27-17+,28-18+,29-21+,30-22+ |
| InChIKey | RHSHSBYSFKTHOV-SBEKHEBASA-N |
| XLogP | 8.73 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.79 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|