C18H33N3 — CID 123384239
N'-(1-amino-6-ethyl-2-methylnona-2,5,8-trienyl)-N-pentan-2-ylmethanimidamide (PubChem CID 123384239) has the molecular formula C18H33N3 and a molecular weight of 291.48 g/mol. Its IUPAC name is N'-(1-amino-6-ethyl-2-methylnona-2,5,8-trienyl)-N-pentan-2-ylmethanimidamide.
| Compound Name | N'-(1-amino-6-ethyl-2-methylnona-2,5,8-trienyl)-N-pentan-2-ylmethanimidamide |
|---|---|
| PubChem CID | 123384239 |
| Molecular Formula | C18H33N3 |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.27 |
| IUPAC Name | N'-(1-amino-6-ethyl-2-methylnona-2,5,8-trienyl)-N-pentan-2-ylmethanimidamide |
| SMILES | C=CCC(=CCC=C(C)C(N)N=CNC(C)CCC)CC |
| InChI | InChI=1S/C18H33N3/c1-6-10-16(5)20-14-21-18(19)15(4)12-9-13-17(8-3)11-7-2/h7,12-14,16,18H,2,6,8-11,19H2,1,3-5H3,(H,20,21) |
| InChIKey | YKXHXUCMPXUDRM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|